About 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile
4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile (PubChem CID 167218914) has the molecular formula C23H30N6O2
and a molecular weight of 422.53 g/mol. Its IUPAC name is 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile.
Molecular Properties
| Compound Name | 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile |
| PubChem CID | 167218914 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile |
| SMILES | N#CCCOC(CCC#N)CC(CCC#N)(CCC#N)CC(CCC#N)OCCC#N |
| InChI | InChI=1S/C23H30N6O2/c24-11-1-7-21(30-17-5-15-28)19-23(9-3-13-26,10-4-14-27)20-22(8-2-12-25)31-18-6-16-29/h21-22H,1-10,17-20H2 |
| InChIKey | STCJDMKTOKRIHR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 161.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile?
The IUPAC name of 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile (CID 167218914) is 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile.
What is the SMILES notation for 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile?
The canonical SMILES for 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile is N#CCCOC(CCC#N)CC(CCC#N)(CCC#N)CC(CCC#N)OCCC#N.
What is the InChIKey of 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile?
The InChIKey is STCJDMKTOKRIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N6O2/c24-11-1-7-21(30-17-5-15-28)19-23(9-3-13-26,10-4-14-27)20-22(8-2-12-25)31-18-6-16-29/h21-22H,1-10,17-20H2.
What are the key properties of 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile?
4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile has a molecular weight of 422.53 g/mol, XLogP of 4.57, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-bis(2-cyanoethoxy)-6,6-bis(2-cyanoethyl)undecanedinitrile is sourced from PubChem (CID 167218914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).