About 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate
3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate (PubChem CID 167219344) has the molecular formula C21H24FNO3S
and a molecular weight of 389.49 g/mol. Its IUPAC name is 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate.
Molecular Properties
| Compound Name | 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate |
| PubChem CID | 167219344 |
| Molecular Formula | C21H24FNO3S |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate |
| SMILES | CC(C)CCOC(=O)CCC(=O)c1cc(C2CNc3c(F)cccc32)cs1 |
| InChI | InChI=1S/C21H24FNO3S/c1-13(2)8-9-26-20(25)7-6-18(24)19-10-14(12-27-19)16-11-23-21-15(16)4-3-5-17(21)22/h3-5,10,12-13,16,23H,6-9,11H2,1-2H3 |
| InChIKey | DGYPXTQMBQMTIH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate?
The IUPAC name of 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate (CID 167219344) is 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate.
What is the SMILES notation for 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate?
The canonical SMILES for 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate is CC(C)CCOC(=O)CCC(=O)c1cc(C2CNc3c(F)cccc32)cs1.
What is the InChIKey of 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate?
The InChIKey is DGYPXTQMBQMTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FNO3S/c1-13(2)8-9-26-20(25)7-6-18(24)19-10-14(12-27-19)16-11-23-21-15(16)4-3-5-17(21)22/h3-5,10,12-13,16,23H,6-9,11H2,1-2H3.
What are the key properties of 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate?
3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate has a molecular weight of 389.49 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 4-[4-(7-fluoro-2,3-dihydro-1H-indol-3-yl)thiophen-2-yl]-4-oxobutanoate is sourced from PubChem (CID 167219344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).