About 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide
4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide (PubChem CID 167219485) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide |
| PubChem CID | 167219485 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide |
| SMILES | CC(C)N1C=CNC(C(N)=O)C1 |
| InChI | InChI=1S/C8H15N3O/c1-6(2)11-4-3-10-7(5-11)8(9)12/h3-4,6-7,10H,5H2,1-2H3,(H2,9,12) |
| InChIKey | YTTSCGWZOYEZJU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide?
The IUPAC name of 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide (CID 167219485) is 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide.
What is the SMILES notation for 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide?
The canonical SMILES for 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide is CC(C)N1C=CNC(C(N)=O)C1.
What is the InChIKey of 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide?
The InChIKey is YTTSCGWZOYEZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-6(2)11-4-3-10-7(5-11)8(9)12/h3-4,6-7,10H,5H2,1-2H3,(H2,9,12).
What are the key properties of 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide?
4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide has a molecular weight of 169.23 g/mol, XLogP of -0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2,3-dihydro-1H-pyrazine-2-carboxamide is sourced from PubChem (CID 167219485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).