C22H25NS — CID 167219589
N-[(1Z,3E)-2-(cyclohepta-1,3,5,6-tetraen-1-ylsulfanylmethyl)-3-ethenyl-7-methyl-5-methylideneocta-1,3,6-trienyl]ethanimine (PubChem CID 167219589) has the molecular formula C22H25NS and a molecular weight of 335.50 g/mol. Its IUPAC name is N-[(1Z,3E)-2-(cyclohepta-1,3,5,6-tetraen-1-ylsulfanylmethyl)-3-ethenyl-7-methyl-5-methylideneocta-1,3,6-trienyl]ethanimine.
| Compound Name | N-[(1Z,3E)-2-(cyclohepta-1,3,5,6-tetraen-1-ylsulfanylmethyl)-3-ethenyl-7-methyl-5-methylideneocta-1,3,6-trienyl]ethanimine |
|---|---|
| PubChem CID | 167219589 |
| Molecular Formula | C22H25NS |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[(1Z,3E)-2-(cyclohepta-1,3,5,6-tetraen-1-ylsulfanylmethyl)-3-ethenyl-7-methyl-5-methylideneocta-1,3,6-trienyl]ethanimine |
| SMILES | CC=N/C=C(\CSC1=CC=CC=C=C1)/C(=C/C(=C)C=C(C)C)/C=C |
| InChI | InChI=1S/C22H25NS/c1-6-20(15-19(5)14-18(3)4)21(16-23-7-2)17-24-22-12-10-8-9-11-13-22/h6-10,12-16H,1,5,17H2,2-4H3/b20-15+,21-16+,23-7? |
| InChIKey | DJIZCUDUMVVWAW-RHLXSGMJSA-N |
| XLogP | 6.70 |
| TPSA | 37.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | 711 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|