C31H48N5O4PS2 — CID 167219831
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[dimethyl(phenyl)-λ4-sulfanyl]undec-10-ynylsulfanyl]propoxy]phosphinic acid (PubChem CID 167219831) has the molecular formula C31H48N5O4PS2 and a molecular weight of 649.86 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[dimethyl(phenyl)-λ4-sulfanyl]undec-10-ynylsulfanyl]propoxy]phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[dimethyl(phenyl)-λ4-sulfanyl]undec-10-ynylsulfanyl]propoxy]phosphinic acid |
|---|---|
| PubChem CID | 167219831 |
| Molecular Formula | C31H48N5O4PS2 |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[3-[11-[dimethyl(phenyl)-λ4-sulfanyl]undec-10-ynylsulfanyl]propoxy]phosphinic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)OCCCSCCCCCCCCCC#CS(C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H48N5O4PS2/c1-27(23-36-25-35-29-30(32)33-24-34-31(29)36)39-26-41(37,38)40-19-16-21-42-20-14-9-7-5-4-6-8-10-15-22-43(2,3)28-17-12-11-13-18-28/h11-13,17-18,24-25,27H,4-10,14,16,19-21,23,26H2,1-3H3,(H,37,38)(H2,32,33,34)/t27-/m1/s1 |
| InChIKey | UAHVJGDBNXRZAH-HHHXNRCGSA-N |
| XLogP | 7.30 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|