C18H28N2O — CID 167219984
(4aR)-9-tert-butyl-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine (PubChem CID 167219984) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (4aR)-9-tert-butyl-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine.
| Compound Name | (4aR)-9-tert-butyl-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine |
|---|---|
| PubChem CID | 167219984 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (4aR)-9-tert-butyl-3,11-dimethyl-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine |
| SMILES | Cc1cc(C(C)(C)C)cc2c1N1CCN(C)C[C@@H]1COC2 |
| InChI | InChI=1S/C18H28N2O/c1-13-8-15(18(2,3)4)9-14-11-21-12-16-10-19(5)6-7-20(16)17(13)14/h8-9,16H,6-7,10-12H2,1-5H3/t16-/m1/s1 |
| InChIKey | HXEZAMPNQOUWCM-MRXNPFEDSA-N |
| XLogP | 2.94 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |