C16H26N2 — CID 167220023
6-[(Z)-but-2-en-2-yl]-7-ethenyl-2-methyl-3,4,8,9,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine (PubChem CID 167220023) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 6-[(Z)-but-2-en-2-yl]-7-ethenyl-2-methyl-3,4,8,9,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine.
| Compound Name | 6-[(Z)-but-2-en-2-yl]-7-ethenyl-2-methyl-3,4,8,9,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine |
|---|---|
| PubChem CID | 167220023 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 6-[(Z)-but-2-en-2-yl]-7-ethenyl-2-methyl-3,4,8,9,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine |
| SMILES | C=CC1=C(/C(C)=C\C)N2CCN(C)CC2CCC1 |
| InChI | InChI=1S/C16H26N2/c1-5-13(3)16-14(6-2)8-7-9-15-12-17(4)10-11-18(15)16/h5-6,15H,2,7-12H2,1,3-4H3/b13-5- |
| InChIKey | XSHRBMKNHQYLJY-ACAGNQJTSA-N |
| XLogP | 3.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |