C23H26F4N4O5 — CID 167221156
4-[[(2S,3R,4R,5S)-3-[4-fluoro-2-(2-methoxyethoxy)-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrimidine-2-carboxamide (PubChem CID 167221156) has the molecular formula C23H26F4N4O5 and a molecular weight of 514.48 g/mol. Its IUPAC name is 4-[[(2S,3R,4R,5S)-3-[4-fluoro-2-(2-methoxyethoxy)-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrimidine-2-carboxamide.
| Compound Name | 4-[[(2S,3R,4R,5S)-3-[4-fluoro-2-(2-methoxyethoxy)-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 167221156 |
| Molecular Formula | C23H26F4N4O5 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 4-[[(2S,3R,4R,5S)-3-[4-fluoro-2-(2-methoxyethoxy)-3-methylphenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carbonyl]amino]pyrimidine-2-carboxamide |
| SMILES | COCCOc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(C(N)=O)n3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1C |
| InChI | InChI=1S/C23H26F4N4O5/c1-11-14(24)6-5-13(17(11)35-10-9-34-4)16-12(2)22(3,23(25,26)27)36-18(16)21(33)31-15-7-8-29-20(30-15)19(28)32/h5-8,12,16,18H,9-10H2,1-4H3,(H2,28,32)(H,29,30,31,33)/t12-,16-,18+,22+/m1/s1 |
| InChIKey | RYYYESXZQAPHFI-JETYEUMLSA-N |
| XLogP | 3.13 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|