C20H26IN3S — CID 167221164
[[(1R,2R)-2-[[(2S)-1-methylpyrrolidin-2-yl]methylamino]-1,2-diphenylethyl]amino] thiohypoiodite (PubChem CID 167221164) has the molecular formula C20H26IN3S and a molecular weight of 467.42 g/mol. Its IUPAC name is [[(1R,2R)-2-[[(2S)-1-methylpyrrolidin-2-yl]methylamino]-1,2-diphenylethyl]amino] thiohypoiodite.
| Compound Name | [[(1R,2R)-2-[[(2S)-1-methylpyrrolidin-2-yl]methylamino]-1,2-diphenylethyl]amino] thiohypoiodite |
|---|---|
| PubChem CID | 167221164 |
| Molecular Formula | C20H26IN3S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | [[(1R,2R)-2-[[(2S)-1-methylpyrrolidin-2-yl]methylamino]-1,2-diphenylethyl]amino] thiohypoiodite |
| SMILES | CN1CCC[C@H]1CN[C@H](c1ccccc1)[C@H](NSI)c1ccccc1 |
| InChI | InChI=1S/C20H26IN3S/c1-24-14-8-13-18(24)15-22-19(16-9-4-2-5-10-16)20(23-25-21)17-11-6-3-7-12-17/h2-7,9-12,18-20,22-23H,8,13-15H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | SWDNNFWBWITBBC-XUVXKRRUSA-N |
| XLogP | 4.74 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|