C9H11F3O2 — CID 167221229
(3R,4S,5R)-3-ethenyl-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one (PubChem CID 167221229) has the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is (3R,4S,5R)-3-ethenyl-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one.
| Compound Name | (3R,4S,5R)-3-ethenyl-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 167221229 |
| Molecular Formula | C9H11F3O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3R,4S,5R)-3-ethenyl-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one |
| SMILES | C=C[C@H]1C(=O)O[C@@](C)(C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C9H11F3O2/c1-4-6-5(2)8(3,9(10,11)12)14-7(6)13/h4-6H,1H2,2-3H3/t5-,6+,8+/m0/s1 |
| InChIKey | SNHSNGBPQKFKIL-SHYZEUOFSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|