C12H14F2O2 — CID 167221232
6-[(3S,4S,5R)-4,5-dimethyloxolan-3-yl]-2,3-difluorophenol (PubChem CID 167221232) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 6-[(3S,4S,5R)-4,5-dimethyloxolan-3-yl]-2,3-difluorophenol.
| Compound Name | 6-[(3S,4S,5R)-4,5-dimethyloxolan-3-yl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 167221232 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 6-[(3S,4S,5R)-4,5-dimethyloxolan-3-yl]-2,3-difluorophenol |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2O)CO[C@@H]1C |
| InChI | InChI=1S/C12H14F2O2/c1-6-7(2)16-5-9(6)8-3-4-10(13)11(14)12(8)15/h3-4,6-7,9,15H,5H2,1-2H3/t6-,7-,9+/m1/s1 |
| InChIKey | JDTLZYVZIWHELJ-BHNWBGBOSA-N |
| XLogP | 2.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |