C34H37F7N6O5 — CID 167221456
(2,3,5,6-tetrafluorophenyl) 4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoate (PubChem CID 167221456) has the molecular formula C34H37F7N6O5 and a molecular weight of 742.69 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 167221456 |
| Molecular Formula | C34H37F7N6O5 |
| Molecular Weight | 742.69 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]benzoate |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(N2CCC(CN3CCN(C[C@H]4OC[C@H](Nc5cncc(C(F)(F)F)n5)[C@@H](O)[C@H]4O)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H37F7N6O5/c35-22-13-23(36)29(38)32(28(22)37)52-33(50)20-1-3-21(4-2-20)47-7-5-19(6-8-47)16-45-9-11-46(12-10-45)17-25-31(49)30(48)24(18-51-25)43-27-15-42-14-26(44-27)34(39,40)41/h1-4,13-15,19,24-25,30-31,48-49H,5-12,16-18H2,(H,43,44)/t24-,25+,30+,31-/m0/s1 |
| InChIKey | BQGXKSKWFNRCQJ-AMZZPRKGSA-N |
| XLogP | 3.71 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.69 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|