C17H23F3N4O8 — CID 167221571
2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 167221571) has the molecular formula C17H23F3N4O8 and a molecular weight of 468.39 g/mol. Its IUPAC name is 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 167221571 |
| Molecular Formula | C17H23F3N4O8 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23F3N4O8/c18-17(19,20)11-4-21-5-12(24-11)23-9-6-32-10(16(29)15(9)28)3-22-13(25)7-30-1-2-31-8-14(26)27/h4-5,9-10,15-16,28-29H,1-3,6-8H2,(H,22,25)(H,23,24)(H,26,27)/t9-,10+,15+,16-/m0/s1 |
| InChIKey | WUQFHSLNKIVBMJ-HRZBSETHSA-N |
| XLogP | -1.37 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|