C14H17F3N6O4 — CID 167221580
(2R,3R,4R,5R,6S)-2-(azidomethyl)-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221580) has the molecular formula C14H17F3N6O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(azidomethyl)-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(azidomethyl)-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221580 |
| Molecular Formula | C14H17F3N6O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(azidomethyl)-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | C=CCO[C@H]1O[C@H](CN=[N+]=[N-])[C@H](O)[C@H](O)[C@H]1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H17F3N6O4/c1-2-5-26-12-9(11(25)10(24)7(27-12)6-20-23-18)22-13-19-4-3-8(21-13)14(15,16)17/h2-4,7,9-12,24-25H,1,5-6H2,(H,19,21,22)/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | XULRLUWFKMOUTD-URYVQPGZSA-N |
| XLogP | 1.24 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|