C11H13F3N6O3 — CID 167221605
(2R,3R,4R,5S)-2-(azidomethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221605) has the molecular formula C11H13F3N6O3 and a molecular weight of 334.26 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(azidomethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(azidomethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221605 |
| Molecular Formula | C11H13F3N6O3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2R,3R,4R,5S)-2-(azidomethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | [N-]=[N+]=NC[C@H]1OC[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H13F3N6O3/c12-11(13,14)7-1-2-16-10(19-7)18-5-4-23-6(3-17-20-15)9(22)8(5)21/h1-2,5-6,8-9,21-22H,3-4H2,(H,16,18,19)/t5-,6+,8+,9-/m0/s1 |
| InChIKey | VUDMUCJCYDHVLM-LWIVVEGESA-N |
| XLogP | 0.71 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|