C15H20F3N3O4 — CID 167221613
(2R,3R,4R,5R,6S)-2-ethyl-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221613) has the molecular formula C15H20F3N3O4 and a molecular weight of 363.34 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-ethyl-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-ethyl-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221613 |
| Molecular Formula | C15H20F3N3O4 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-ethyl-6-prop-2-enoxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | C=CCO[C@H]1O[C@H](CC)[C@H](O)[C@H](O)[C@H]1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H20F3N3O4/c1-3-7-24-13-10(12(23)11(22)8(4-2)25-13)21-14-19-6-5-9(20-14)15(16,17)18/h3,5-6,8,10-13,22-23H,1,4,7H2,2H3,(H,19,20,21)/t8-,10-,11+,12-,13+/m1/s1 |
| InChIKey | PAJZXDPONSWPGE-ZMHPAJMFSA-N |
| XLogP | 1.34 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|