C25H28F7N3O9 — CID 167221717
(2,3,5,6-tetrafluorophenyl) 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 167221717) has the molecular formula C25H28F7N3O9 and a molecular weight of 647.50 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 167221717 |
| Molecular Formula | C25H28F7N3O9 |
| Molecular Weight | 647.50 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCCOCCOC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H28F7N3O9/c26-13-7-14(27)21(29)24(20(13)28)44-19(36)12-42-6-4-40-2-1-39-3-5-41-11-16-23(38)22(37)15(10-43-16)34-18-9-33-8-17(35-18)25(30,31)32/h7-9,15-16,22-23,37-38H,1-6,10-12H2,(H,34,35)/t15-,16+,22+,23-/m0/s1 |
| InChIKey | IOBTZPYXZTVXEW-FTJWQGMPSA-N |
| XLogP | 1.62 |
| TPSA | 150.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|