C14H17F3N4O6 — CID 167221728
3-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-3-oxopropanoic acid (PubChem CID 167221728) has the molecular formula C14H17F3N4O6 and a molecular weight of 394.31 g/mol. Its IUPAC name is 3-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-3-oxopropanoic acid.
| Compound Name | 3-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167221728 |
| Molecular Formula | C14H17F3N4O6 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17F3N4O6/c15-14(16,17)8-3-18-4-9(21-8)20-6-5-27-7(13(26)12(6)25)2-19-10(22)1-11(23)24/h3-4,6-7,12-13,25-26H,1-2,5H2,(H,19,22)(H,20,21)(H,23,24)/t6-,7+,12+,13-/m0/s1 |
| InChIKey | HEKHJEODONUPIM-CLBUKXALSA-N |
| XLogP | -1.01 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|