C22H34F3N3O8 — CID 167221731
2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 167221731) has the molecular formula C22H34F3N3O8 and a molecular weight of 525.52 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 167221731 |
| Molecular Formula | C22H34F3N3O8 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2COCCOCCOCCOCCO |
| InChI | InChI=1S/C22H34F3N3O8/c1-21(2)35-19-15(27-18-12-26-11-17(28-18)22(23,24)25)13-34-16(20(19)36-21)14-33-10-9-32-8-7-31-6-5-30-4-3-29/h11-12,15-16,19-20,29H,3-10,13-14H2,1-2H3,(H,27,28)/t15-,16+,19+,20-/m0/s1 |
| InChIKey | PYTATWGEYZFWMP-FIYPYCPBSA-N |
| XLogP | 1.25 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|