C22H32F3N3O9 — CID 167221771
2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 167221771) has the molecular formula C22H32F3N3O9 and a molecular weight of 539.50 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 167221771 |
| Molecular Formula | C22H32F3N3O9 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[2-[2-[2-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1nccc(C(F)(F)F)n1)CO[C@@H]2COCCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C22H32F3N3O9/c1-21(2)36-18-14(27-20-26-4-3-16(28-20)22(23,24)25)11-35-15(19(18)37-21)12-33-9-7-31-5-6-32-8-10-34-13-17(29)30/h3-4,14-15,18-19H,5-13H2,1-2H3,(H,29,30)(H,26,27,28)/t14-,15+,18+,19-/m0/s1 |
| InChIKey | SEBQSRVCNUUMFU-SFUIVIKGSA-N |
| XLogP | 1.35 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|