C13H18F3N3O5 — CID 167221782
(2R,3R,4R,5R,6R)-6-ethoxy-2-(hydroxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221782) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-6-ethoxy-2-(hydroxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-6-ethoxy-2-(hydroxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221782 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R,3R,4R,5R,6R)-6-ethoxy-2-(hydroxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | CCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H18F3N3O5/c1-2-23-12-9(11(22)10(21)6(5-20)24-12)19-8-4-17-3-7(18-8)13(14,15)16/h3-4,6,9-12,20-22H,2,5H2,1H3,(H,18,19)/t6-,9-,10+,11-,12-/m1/s1 |
| InChIKey | DLDFUJWSWHQPIR-UJDFUTJXSA-N |
| XLogP | -0.25 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |