C13H15F3N2O5 — CID 167221786
(1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167221786) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167221786 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-(hydroxymethyl)-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | OC[C@@]12CO[C@@H](O1)[C@H](Nc1cccc(C(F)(F)F)n1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C13H15F3N2O5/c14-13(15,16)6-2-1-3-7(17-6)18-8-9(20)10(21)12(4-19)5-22-11(8)23-12/h1-3,8-11,19-21H,4-5H2,(H,17,18)/t8-,9-,10-,11+,12+/m1/s1 |
| InChIKey | DYWXJLCKYXQIBG-JCIQBVFBSA-N |
| XLogP | -0.28 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |