C19H23F3N4O3 — CID 167221832
(2R,3R,4R,5S)-2-[(N,3-dimethylanilino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221832) has the molecular formula C19H23F3N4O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[(N,3-dimethylanilino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[(N,3-dimethylanilino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221832 |
| Molecular Formula | C19H23F3N4O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-[(N,3-dimethylanilino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | Cc1cccc(N(C)C[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C19H23F3N4O3/c1-11-4-3-5-12(6-11)26(2)9-14-18(28)17(27)13(10-29-14)24-16-8-23-7-15(25-16)19(20,21)22/h3-8,13-14,17-18,27-28H,9-10H2,1-2H3,(H,24,25)/t13-,14+,17+,18-/m0/s1 |
| InChIKey | YJXDILDSENJMDB-JFTQMJAMSA-N |
| XLogP | 1.84 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |