C22H35F3N4O7 — CID 167221833
N-[(3aR,4R,7S,7aR)-4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 167221833) has the molecular formula C22H35F3N4O7 and a molecular weight of 524.54 g/mol. Its IUPAC name is N-[(3aR,4R,7S,7aR)-4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aR,4R,7S,7aR)-4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 167221833 |
| Molecular Formula | C22H35F3N4O7 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | N-[(3aR,4R,7S,7aR)-4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2COCCOCCOCCOCCN |
| InChI | InChI=1S/C22H35F3N4O7/c1-21(2)35-19-15(28-18-12-27-11-17(29-18)22(23,24)25)13-34-16(20(19)36-21)14-33-10-9-32-8-7-31-6-5-30-4-3-26/h11-12,15-16,19-20H,3-10,13-14,26H2,1-2H3,(H,28,29)/t15-,16+,19+,20-/m0/s1 |
| InChIKey | TVLXAQFHGURWDJ-FIYPYCPBSA-N |
| XLogP | 1.22 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|