C34H45F3N4O4 — CID 167221908
cyclopentyl-[4-[4-[2-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]ethyl]piperidin-1-yl]phenyl]methanone (PubChem CID 167221908) has the molecular formula C34H45F3N4O4 and a molecular weight of 630.75 g/mol. Its IUPAC name is cyclopentyl-[4-[4-[2-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]ethyl]piperidin-1-yl]phenyl]methanone.
| Compound Name | cyclopentyl-[4-[4-[2-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]ethyl]piperidin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 167221908 |
| Molecular Formula | C34H45F3N4O4 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | cyclopentyl-[4-[4-[2-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]ethyl]piperidin-1-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(N2CCC(CCC3CCC([C@H]4OC[C@H](Nc5cncc(C(F)(F)F)n5)[C@@H](O)[C@H]4O)C3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C34H45F3N4O4/c35-34(36,37)28-18-38-19-29(40-28)39-27-20-45-33(32(44)31(27)43)25-8-7-22(17-25)6-5-21-13-15-41(16-14-21)26-11-9-24(10-12-26)30(42)23-3-1-2-4-23/h9-12,18-19,21-23,25,27,31-33,43-44H,1-8,13-17,20H2,(H,39,40)/t22?,25?,27-,31+,32+,33+/m0/s1 |
| InChIKey | DFSCYOBGPCUIKZ-HIKXMNSQSA-N |
| XLogP | 5.88 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |