C27H38F3N3O7 — CID 167221914
1-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-3-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]propan-2-one (PubChem CID 167221914) has the molecular formula C27H38F3N3O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is 1-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-3-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]propan-2-one.
| Compound Name | 1-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-3-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]propan-2-one |
|---|---|
| PubChem CID | 167221914 |
| Molecular Formula | C27H38F3N3O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 1-[2-(2-cyclopentyl-2-oxoethoxy)ethoxy]-3-[3-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]cyclopentyl]propan-2-one |
| SMILES | O=C(COCCOCC(=O)C1CCCC1)CC1CCC([C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C27H38F3N3O7/c28-27(29,30)22-11-31-12-23(33-22)32-20-14-40-26(25(37)24(20)36)18-6-5-16(9-18)10-19(34)13-38-7-8-39-15-21(35)17-3-1-2-4-17/h11-12,16-18,20,24-26,36-37H,1-10,13-15H2,(H,32,33)/t16?,18?,20-,24+,25+,26+/m0/s1 |
| InChIKey | SXBKGCTVLAOVNT-CPRRPXFDSA-N |
| XLogP | 2.56 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|