C29H41F3N2O4 — CID 167221915
(1S,2R,3R,4R,5S)-1-[[3-[[3-(cyclopentylmethyl)cyclopentyl]methyl]cyclobutyl]methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167221915) has the molecular formula C29H41F3N2O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-[[3-[[3-(cyclopentylmethyl)cyclopentyl]methyl]cyclobutyl]methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-[[3-[[3-(cyclopentylmethyl)cyclopentyl]methyl]cyclobutyl]methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167221915 |
| Molecular Formula | C29H41F3N2O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-[[3-[[3-(cyclopentylmethyl)cyclopentyl]methyl]cyclobutyl]methyl]-4-[[6-(trifluoromethyl)-2-pyridinyl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cccc(C(F)(F)F)n2)[C@H]2OC[C@](CC3CC(CC4CCC(CC5CCCC5)C4)C3)(O2)[C@@H]1O |
| InChI | InChI=1S/C29H41F3N2O4/c30-29(31,32)22-6-3-7-23(33-22)34-24-25(35)26(36)28(16-37-27(24)38-28)15-21-13-20(14-21)12-19-9-8-18(11-19)10-17-4-1-2-5-17/h3,6-7,17-21,24-27,35-36H,1-2,4-5,8-16H2,(H,33,34)/t18?,19?,20?,21?,24-,25-,26-,27+,28+/m1/s1 |
| InChIKey | PKBUHGYDKBTPEL-WHOICWARSA-N |
| XLogP | 5.53 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |