C28H40F3N3O4 — CID 167221919
(1S,2R,3R,4R,5S)-1-[[3-[2-[3-(2-cyclobutylethyl)cyclobutyl]ethyl]cyclobutyl]methyl]-4-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167221919) has the molecular formula C28H40F3N3O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-1-[[3-[2-[3-(2-cyclobutylethyl)cyclobutyl]ethyl]cyclobutyl]methyl]-4-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-1-[[3-[2-[3-(2-cyclobutylethyl)cyclobutyl]ethyl]cyclobutyl]methyl]-4-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167221919 |
| Molecular Formula | C28H40F3N3O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | (1S,2R,3R,4R,5S)-1-[[3-[2-[3-(2-cyclobutylethyl)cyclobutyl]ethyl]cyclobutyl]methyl]-4-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | O[C@@H]1[C@@H](Nc2ccnc(C(F)(F)F)n2)[C@H]2OC[C@](CC3CC(CCC4CC(CCC5CCC5)C4)C3)(O2)[C@@H]1O |
| InChI | InChI=1S/C28H40F3N3O4/c29-28(30,31)26-32-9-8-21(34-26)33-22-23(35)24(36)27(15-37-25(22)38-27)14-20-12-19(13-20)7-6-18-10-17(11-18)5-4-16-2-1-3-16/h8-9,16-20,22-25,35-36H,1-7,10-15H2,(H,32,33,34)/t17?,18?,19?,20?,22-,23-,24-,25+,27+/m1/s1 |
| InChIKey | OOVUTZJLGVYSJS-XPFKXPIDSA-N |
| XLogP | 4.93 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |