C22H29F3N4O4 — CID 167221951
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]adamantane-1-carboxamide (PubChem CID 167221951) has the molecular formula C22H29F3N4O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 167221951 |
| Molecular Formula | C22H29F3N4O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29F3N4O4/c23-22(24,25)16-8-26-9-17(29-16)28-14-10-33-15(19(31)18(14)30)7-27-20(32)21-4-11-1-12(5-21)3-13(2-11)6-21/h8-9,11-15,18-19,30-31H,1-7,10H2,(H,27,32)(H,28,29)/t11?,12?,13?,14-,15+,18+,19-,21?/m0/s1 |
| InChIKey | UAFSFUVUHYUANU-KLSXOVFUSA-N |
| XLogP | 1.73 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |