C17H20F3N5O4S — CID 167221953
(2R,3R,4R,5S)-2-[[(phenylsulfonimidoyl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 167221953) has the molecular formula C17H20F3N5O4S and a molecular weight of 447.44 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[(phenylsulfonimidoyl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[[(phenylsulfonimidoyl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 167221953 |
| Molecular Formula | C17H20F3N5O4S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[(phenylsulfonimidoyl)amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | [H]N=S(=O)(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C17H20F3N5O4S/c18-17(19,20)13-7-22-8-14(25-13)24-11-9-29-12(16(27)15(11)26)6-23-30(21,28)10-4-2-1-3-5-10/h1-5,7-8,11-12,15-16,26-27H,6,9H2,(H,24,25)(H2,21,23,28)/t11-,12+,15+,16-,30?/m0/s1 |
| InChIKey | VPUOWWAXFLUUDI-PIGMAQCZSA-N |
| XLogP | 1.01 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |