C6H8F3N3 — CID 167221961
N'-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]ethanimidamide (PubChem CID 167221961) has the molecular formula C6H8F3N3 and a molecular weight of 179.15 g/mol. Its IUPAC name is N'-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]ethanimidamide.
| Compound Name | N'-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 167221961 |
| Molecular Formula | C6H8F3N3 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N'-[(Z)-3,3,3-trifluoro-1-(methylideneamino)prop-1-en-2-yl]ethanimidamide |
| SMILES | C=N/C=C(\N=C(/C)N)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3/c1-4(10)12-5(3-11-2)6(7,8)9/h3H,2H2,1H3,(H2,10,12)/b5-3- |
| InChIKey | LSRBOTXQUWOAEB-HYXAFXHYSA-N |
| XLogP | 1.47 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|