C24H29F3N4O8 — CID 167221983
benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 167221983) has the molecular formula C24H29F3N4O8 and a molecular weight of 558.51 g/mol. Its IUPAC name is benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 167221983 |
| Molecular Formula | C24H29F3N4O8 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCC(=O)OCc1ccccc1)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H29F3N4O8/c25-24(26,27)18-9-28-10-19(31-18)30-16-12-38-17(23(35)22(16)34)8-29-20(32)13-36-6-7-37-14-21(33)39-11-15-4-2-1-3-5-15/h1-5,9-10,16-17,22-23,34-35H,6-8,11-14H2,(H,29,32)(H,30,31)/t16-,17+,22+,23-/m0/s1 |
| InChIKey | FMFABWYPZXYQEU-QOKUDNMUSA-N |
| XLogP | 0.29 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|