C23H36F3N5O5 — CID 167222028
tert-butyl 4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]ethyl]piperidine-1-carboxylate (PubChem CID 167222028) has the molecular formula C23H36F3N5O5 and a molecular weight of 519.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167222028 |
| Molecular Formula | C23H36F3N5O5 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl 4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C23H36F3N5O5/c1-22(2,3)36-21(34)31-8-5-14(6-9-31)4-7-27-10-16-20(33)19(32)15(13-35-16)29-18-12-28-11-17(30-18)23(24,25)26/h11-12,14-16,19-20,27,32-33H,4-10,13H2,1-3H3,(H,29,30)/t15-,16+,19+,20-/m0/s1 |
| InChIKey | GXFDLQSZLVOSCZ-FIYPYCPBSA-N |
| XLogP | 2.02 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|