C33H34FNO3 — CID 16722203
(1S,3aR,3bS,10R,11aS)-10-[4-(dimethylamino)phenyl]-1-[2-(4-fluorophenyl)ethynyl]-1-hydroxy-11a-methyl-3,3a,3b,5,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one (PubChem CID 16722203) has the molecular formula C33H34FNO3 and a molecular weight of 511.64 g/mol. Its IUPAC name is (1S,3aR,3bS,10R,11aS)-10-[4-(dimethylamino)phenyl]-1-[2-(4-fluorophenyl)ethynyl]-1-hydroxy-11a-methyl-3,3a,3b,5,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one.
| Compound Name | (1S,3aR,3bS,10R,11aS)-10-[4-(dimethylamino)phenyl]-1-[2-(4-fluorophenyl)ethynyl]-1-hydroxy-11a-methyl-3,3a,3b,5,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
|---|---|
| PubChem CID | 16722203 |
| Molecular Formula | C33H34FNO3 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (1S,3aR,3bS,10R,11aS)-10-[4-(dimethylamino)phenyl]-1-[2-(4-fluorophenyl)ethynyl]-1-hydroxy-11a-methyl-3,3a,3b,5,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
| SMILES | CN(C)c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccc(F)cc3)[C@@H]3OCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C33H34FNO3/c1-32-19-28(22-6-10-25(11-7-22)35(2)3)30-27-13-12-26(36)18-23(27)20-38-31(30)29(32)15-17-33(32,37)16-14-21-4-8-24(34)9-5-21/h4-11,18,28-29,31,37H,12-13,15,17,19-20H2,1-3H3/t28-,29+,31+,32+,33+/m1/s1 |
| InChIKey | QMITVKPWYUNGDV-ZDRBTZMISA-N |
| XLogP | 5.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|