C15H21F3N4O3 — CID 167222143
N-[(3aS,4R,7S,7aR)-2,2-dimethyl-4-(methylaminomethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 167222143) has the molecular formula C15H21F3N4O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-[(3aS,4R,7S,7aR)-2,2-dimethyl-4-(methylaminomethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aS,4R,7S,7aR)-2,2-dimethyl-4-(methylaminomethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 167222143 |
| Molecular Formula | C15H21F3N4O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[(3aS,4R,7S,7aR)-2,2-dimethyl-4-(methylaminomethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CNC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H21F3N4O3/c1-14(2)24-12-8(7-23-9(4-19-3)13(12)25-14)21-11-6-20-5-10(22-11)15(16,17)18/h5-6,8-9,12-13,19H,4,7H2,1-3H3,(H,21,22)/t8-,9+,12+,13-/m0/s1 |
| InChIKey | UAPXMHPYPULRIW-ZFWZSOMGSA-N |
| XLogP | 1.41 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |