C9H10F3N — CID 167222148
N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropenta-3,4-dien-2-imine (PubChem CID 167222148) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropenta-3,4-dien-2-imine.
| Compound Name | N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropenta-3,4-dien-2-imine |
|---|---|
| PubChem CID | 167222148 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropenta-3,4-dien-2-imine |
| SMILES | C=C=C/C(=N\C(C)=C/C)C(F)(F)F |
| InChI | InChI=1S/C9H10F3N/c1-4-6-8(9(10,11)12)13-7(3)5-2/h5-6H,1H2,2-3H3/b7-5-,13-8+ |
| InChIKey | BZWMYGOOZHDJDG-IPYMFYIGSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|