C13H17F3N4O3 — CID 167222175
(2R,3R,4R)-2-(methylaminomethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol (PubChem CID 167222175) has the molecular formula C13H17F3N4O3 and a molecular weight of 334.30 g/mol. Its IUPAC name is (2R,3R,4R)-2-(methylaminomethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(methylaminomethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 167222175 |
| Molecular Formula | C13H17F3N4O3 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2R,3R,4R)-2-(methylaminomethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
| SMILES | CNC[C@H]1OCC(/C=N/c2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17F3N4O3/c1-17-3-8-12(22)11(21)7(6-23-8)2-19-10-5-18-4-9(20-10)13(14,15)16/h2,4-5,7-8,11-12,17,21-22H,3,6H2,1H3/b19-2+/t7?,8-,11-,12+/m1/s1 |
| InChIKey | TZIZRYCMBZMZSF-BTFMVQCZSA-N |
| XLogP | 0.15 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|