C18H23F3N4O4 — CID 167222176
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 167222176) has the molecular formula C18H23F3N4O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 167222176 |
| Molecular Formula | C18H23F3N4O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]bicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)C12CCC(C1)C2 |
| InChI | InChI=1S/C18H23F3N4O4/c19-18(20,21)12-6-22-7-13(25-12)24-10-8-29-11(15(27)14(10)26)5-23-16(28)17-2-1-9(3-17)4-17/h6-7,9-11,14-15,26-27H,1-5,8H2,(H,23,28)(H,24,25)/t9?,10-,11+,14+,15-,17?/m0/s1 |
| InChIKey | GNAOWQJKDITZTO-NKMGZEHJSA-N |
| XLogP | 0.70 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |