C14H19F3N4O3 — CID 167222182
(2R,3R,4R)-2-[(dimethylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol (PubChem CID 167222182) has the molecular formula C14H19F3N4O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(dimethylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[(dimethylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 167222182 |
| Molecular Formula | C14H19F3N4O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2R,3R,4R)-2-[(dimethylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
| SMILES | CN(C)C[C@H]1OCC(/C=N/c2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19F3N4O3/c1-21(2)6-9-13(23)12(22)8(7-24-9)3-19-11-5-18-4-10(20-11)14(15,16)17/h3-5,8-9,12-13,22-23H,6-7H2,1-2H3/b19-3+/t8?,9-,12-,13+/m1/s1 |
| InChIKey | LEMHZMNUAGOYFO-AGEYFUNQSA-N |
| XLogP | 0.50 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|