C16H21N3O — CID 167222214
4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3-methylimidazol-4-yl)methyl]pyrrolidin-2-one (PubChem CID 167222214) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3-methylimidazol-4-yl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3-methylimidazol-4-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 167222214 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-[(3-methylimidazol-4-yl)methyl]pyrrolidin-2-one |
| SMILES | C=C/C=C\C(=C/C)C1CC(=O)N(Cc2cncn2C)C1 |
| InChI | InChI=1S/C16H21N3O/c1-4-6-7-13(5-2)14-8-16(20)19(10-14)11-15-9-17-12-18(15)3/h4-7,9,12,14H,1,8,10-11H2,2-3H3/b7-6-,13-5+ |
| InChIKey | OMCSFSUBGOGGCA-ZQNRWWJISA-N |
| XLogP | 2.46 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|