About 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol
1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol (PubChem CID 16722240) has the molecular formula C23H17Cl2N3O
and a molecular weight of 422.32 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol.
Molecular Properties
| Compound Name | 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol |
| PubChem CID | 16722240 |
| Molecular Formula | C23H17Cl2N3O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol |
| SMILES | OC(c1cccnc1-c1cccc(Cl)c1Cl)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C23H17Cl2N3O/c24-19-9-1-7-17(21(19)25)22-18(8-4-12-28-22)23(29)20(15-5-2-10-26-13-15)16-6-3-11-27-14-16/h1-14,20,23,29H |
| InChIKey | MONUPDKEKDGEQN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol?
The IUPAC name of 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol (CID 16722240) is 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol.
What is the SMILES notation for 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol?
The canonical SMILES for 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol is OC(c1cccnc1-c1cccc(Cl)c1Cl)C(c1cccnc1)c1cccnc1.
What is the InChIKey of 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol?
The InChIKey is MONUPDKEKDGEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2N3O/c24-19-9-1-7-17(21(19)25)22-18(8-4-12-28-22)23(29)20(15-5-2-10-26-13-15)16-6-3-11-27-14-16/h1-14,20,23,29H.
What are the key properties of 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol?
1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol has a molecular weight of 422.32 g/mol, XLogP of 5.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,3-dichlorophenyl)-3-pyridinyl]-2,2-dipyridin-3-ylethanol is sourced from PubChem (CID 16722240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).