About 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan
3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan (PubChem CID 167222828) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan.
Molecular Properties
| Compound Name | 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan |
| PubChem CID | 167222828 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan |
| SMILES | CC(C)C1C=CC=C(c2ccoc2)C1 |
| InChI | InChI=1S/C13H16O/c1-10(2)11-4-3-5-12(8-11)13-6-7-14-9-13/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | MJUPAVFOCJDHLI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan?
The IUPAC name of 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan (CID 167222828) is 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan.
What is the SMILES notation for 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan?
The canonical SMILES for 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan is CC(C)C1C=CC=C(c2ccoc2)C1.
What is the InChIKey of 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan?
The InChIKey is MJUPAVFOCJDHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-10(2)11-4-3-5-12(8-11)13-6-7-14-9-13/h3-7,9-11H,8H2,1-2H3.
What are the key properties of 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan?
3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan has a molecular weight of 188.27 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-propan-2-ylcyclohexa-1,3-dien-1-yl)furan is sourced from PubChem (CID 167222828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).