C19H26FNOS — CID 167222848
(4E,6E,8Z)-3-amino-6-[(3-fluorocyclohepta-2,4,6-trien-1-yl)methoxy]-7-methyldeca-4,6,8-triene-1-thiol (PubChem CID 167222848) has the molecular formula C19H26FNOS and a molecular weight of 335.49 g/mol. Its IUPAC name is (4E,6E,8Z)-3-amino-6-[(3-fluorocyclohepta-2,4,6-trien-1-yl)methoxy]-7-methyldeca-4,6,8-triene-1-thiol.
| Compound Name | (4E,6E,8Z)-3-amino-6-[(3-fluorocyclohepta-2,4,6-trien-1-yl)methoxy]-7-methyldeca-4,6,8-triene-1-thiol |
|---|---|
| PubChem CID | 167222848 |
| Molecular Formula | C19H26FNOS |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (4E,6E,8Z)-3-amino-6-[(3-fluorocyclohepta-2,4,6-trien-1-yl)methoxy]-7-methyldeca-4,6,8-triene-1-thiol |
| SMILES | C/C=C\C(C)=C(/C=C/C(N)CCS)OCC1C=CC=CC(F)=C1 |
| InChI | InChI=1S/C19H26FNOS/c1-3-6-15(2)19(10-9-18(21)11-12-23)22-14-16-7-4-5-8-17(20)13-16/h3-10,13,16,18,23H,11-12,14,21H2,1-2H3/b6-3-,10-9+,19-15+ |
| InChIKey | SNCPJOGVSCHDHC-WFWNCODMSA-N |
| XLogP | 4.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|