C14H24FN3S — CID 167222853
(4E,6E)-3-amino-6-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]-4-[(E)-2-fluoroethenyl]octa-4,6-diene-1-thiol (PubChem CID 167222853) has the molecular formula C14H24FN3S and a molecular weight of 285.43 g/mol. Its IUPAC name is (4E,6E)-3-amino-6-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]-4-[(E)-2-fluoroethenyl]octa-4,6-diene-1-thiol.
| Compound Name | (4E,6E)-3-amino-6-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]-4-[(E)-2-fluoroethenyl]octa-4,6-diene-1-thiol |
|---|---|
| PubChem CID | 167222853 |
| Molecular Formula | C14H24FN3S |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (4E,6E)-3-amino-6-[(Z)-3-amino-1-(methylamino)prop-1-en-2-yl]-4-[(E)-2-fluoroethenyl]octa-4,6-diene-1-thiol |
| SMILES | C/C=C(\C=C(/C=C/F)C(N)CCS)C(=C/NC)/CN |
| InChI | InChI=1S/C14H24FN3S/c1-3-11(13(9-16)10-18-2)8-12(4-6-15)14(17)5-7-19/h3-4,6,8,10,14,18-19H,5,7,9,16-17H2,1-2H3/b6-4+,11-3+,12-8+,13-10+ |
| InChIKey | AZGVALPNMBODPK-MFZQNIHOSA-N |
| XLogP | 2.05 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|