C20H19NS — CID 167223145
2-methyl-1-[(1Z)-penta-1,4-dienyl]-8,9-dihydro-3H-[1]benzothiolo[2,3-e]indole (PubChem CID 167223145) has the molecular formula C20H19NS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-methyl-1-[(1Z)-penta-1,4-dienyl]-8,9-dihydro-3H-[1]benzothiolo[2,3-e]indole.
| Compound Name | 2-methyl-1-[(1Z)-penta-1,4-dienyl]-8,9-dihydro-3H-[1]benzothiolo[2,3-e]indole |
|---|---|
| PubChem CID | 167223145 |
| Molecular Formula | C20H19NS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-methyl-1-[(1Z)-penta-1,4-dienyl]-8,9-dihydro-3H-[1]benzothiolo[2,3-e]indole |
| SMILES | C=CC/C=C\c1c(C)[nH]c2ccc3c4c(sc3c12)CCC=C4 |
| InChI | InChI=1S/C20H19NS/c1-3-4-5-8-14-13(2)21-17-12-11-16-15-9-6-7-10-18(15)22-20(16)19(14)17/h3,5-6,8-9,11-12,21H,1,4,7,10H2,2H3/b8-5- |
| InChIKey | SMAXPFGSOMZHHH-YVMONPNESA-N |
| XLogP | 6.24 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|