About methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate
methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate (PubChem CID 16722321) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate |
| PubChem CID | 16722321 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate |
| SMILES | COC(=O)C(C)Cn1ccc2cc(C(=O)N3CC4(C)CC3CC(C)(C)C4)ccc21 |
| InChI | InChI=1S/C24H32N2O3/c1-16(22(28)29-5)13-25-9-8-17-10-18(6-7-20(17)25)21(27)26-15-24(4)12-19(26)11-23(2,3)14-24/h6-10,16,19H,11-15H2,1-5H3 |
| InChIKey | BMKXRSAGBPCDEF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate?
The IUPAC name of methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate (CID 16722321) is methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate.
What is the SMILES notation for methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate?
The canonical SMILES for methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate is COC(=O)C(C)Cn1ccc2cc(C(=O)N3CC4(C)CC3CC(C)(C)C4)ccc21.
What is the InChIKey of methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate?
The InChIKey is BMKXRSAGBPCDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O3/c1-16(22(28)29-5)13-25-9-8-17-10-18(6-7-20(17)25)21(27)26-15-24(4)12-19(26)11-23(2,3)14-24/h6-10,16,19H,11-15H2,1-5H3.
What are the key properties of methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate?
methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate has a molecular weight of 396.53 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-[5-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl)indol-1-yl]propanoate is sourced from PubChem (CID 16722321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).