About methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate
methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 167223562) has the molecular formula C9H10INO2
and a molecular weight of 291.09 g/mol. Its IUPAC name is methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 167223562 |
| Molecular Formula | C9H10INO2 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | [H]/N=C(\I)[C@@H]1C=C(C(=O)OC)C=CC1 |
| InChI | InChI=1S/C9H10INO2/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2,4-6,11H,3H2,1H3/b11-8-/t6-/m0/s1 |
| InChIKey | ZZMKKBXYCMTUSH-ZMOUMYSOSA-N |
| XLogP | 2.07 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate (CID 167223562) is methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate is [H]/N=C(\I)[C@@H]1C=C(C(=O)OC)C=CC1.
What is the InChIKey of methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate?
The InChIKey is ZZMKKBXYCMTUSH-ZMOUMYSOSA-N. The full InChI is InChI=1S/C9H10INO2/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2,4-6,11H,3H2,1H3/b11-8-/t6-/m0/s1.
What are the key properties of methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate?
methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate has a molecular weight of 291.09 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-carbonimidiodidoylcyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 167223562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).