About 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole
2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole (PubChem CID 167223610) has the molecular formula C20H17NS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole.
Molecular Properties
| Compound Name | 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole |
| PubChem CID | 167223610 |
| Molecular Formula | C20H17NS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole |
| SMILES | C=Cc1c(/C=C\CC)[nH]c2c1ccc1c3ccccc3sc12 |
| InChI | InChI=1S/C20H17NS/c1-3-5-9-17-13(4-2)15-11-12-16-14-8-6-7-10-18(14)22-20(16)19(15)21-17/h4-12,21H,2-3H2,1H3/b9-5- |
| InChIKey | FGQFKROWAURQHQ-UITAMQMPSA-N |
| XLogP | 6.60 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole?
The IUPAC name of 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole (CID 167223610) is 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole.
What is the SMILES notation for 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole?
The canonical SMILES for 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole is C=Cc1c(/C=C\CC)[nH]c2c1ccc1c3ccccc3sc12.
What is the InChIKey of 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole?
The InChIKey is FGQFKROWAURQHQ-UITAMQMPSA-N. The full InChI is InChI=1S/C20H17NS/c1-3-5-9-17-13(4-2)15-11-12-16-14-8-6-7-10-18(14)22-20(16)19(15)21-17/h4-12,21H,2-3H2,1H3/b9-5-.
What are the key properties of 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole?
2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole has a molecular weight of 303.43 g/mol, XLogP of 6.60, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-1-enyl]-3-ethenyl-1H-[1]benzothiolo[3,2-g]indole is sourced from PubChem (CID 167223610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).