C39H28N4O — CID 167223794
9-[6-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-yl]carbazole (PubChem CID 167223794) has the molecular formula C39H28N4O and a molecular weight of 568.68 g/mol. Its IUPAC name is 9-[6-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-yl]carbazole.
| Compound Name | 9-[6-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-yl]carbazole |
|---|---|
| PubChem CID | 167223794 |
| Molecular Formula | C39H28N4O |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 9-[6-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzofuran-1-yl]carbazole |
| SMILES | C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2cccc3c2oc2cccc(-n4c5ccccc5c5ccccc54)c23)n1 |
| InChI | InChI=1S/C39H28N4O/c1-3-4-14-25(2)37-40-38(26-15-6-5-7-16-26)42-39(41-37)30-20-12-19-29-35-33(23-13-24-34(35)44-36(29)30)43-31-21-10-8-17-27(31)28-18-9-11-22-32(28)43/h3-24H,1-2H3/b4-3-,25-14+ |
| InChIKey | VQVOVWITFAFAGJ-WFUUWAEPSA-N |
| XLogP | 10.18 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|