C26H33N5O — CID 167224000
4-N-[1-benzyl-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]imidazo[4,5-b]pyridin-2-yl]cyclohexane-1,4-diamine (PubChem CID 167224000) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-N-[1-benzyl-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]imidazo[4,5-b]pyridin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[1-benzyl-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]imidazo[4,5-b]pyridin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 167224000 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 4-N-[1-benzyl-6-[(3E)-4-methoxy-2-methylpenta-1,3-dien-3-yl]imidazo[4,5-b]pyridin-2-yl]cyclohexane-1,4-diamine |
| SMILES | C=C(C)/C(=C(/C)OC)c1cnc2nc(NC3CCC(N)CC3)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H33N5O/c1-17(2)24(18(3)32-4)20-14-23-25(28-15-20)30-26(29-22-12-10-21(27)11-13-22)31(23)16-19-8-6-5-7-9-19/h5-9,14-15,21-22H,1,10-13,16,27H2,2-4H3,(H,28,29,30)/b24-18+ |
| InChIKey | KEIQFVFNJGKFAS-HKOYGPOVSA-N |
| XLogP | 5.11 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|